C13H11BrF3NO — CID 115861367
N-[(3-bromofuran-2-yl)-(2,4,6-trifluorophenyl)methyl]ethanamine (PubChem CID 115861367) has the molecular formula C13H11BrF3NO and a molecular weight of 334.14 g/mol. Its IUPAC name is N-[(3-bromofuran-2-yl)-(2,4,6-trifluorophenyl)methyl]ethanamine.
| Compound Name | N-[(3-bromofuran-2-yl)-(2,4,6-trifluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 115861367 |
| Molecular Formula | C13H11BrF3NO |
| Molecular Weight | 334.14 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | N-[(3-bromofuran-2-yl)-(2,4,6-trifluorophenyl)methyl]ethanamine |
| SMILES | CCNC(c1occc1Br)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C13H11BrF3NO/c1-2-18-12(13-8(14)3-4-19-13)11-9(16)5-7(15)6-10(11)17/h3-6,12,18H,2H2,1H3 |
| InChIKey | USORWXKCSMZJGI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.14 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |