C9H14BrNO3S — CID 115861480
1-(3-bromofuran-2-yl)-2-methyl-2-methylsulfonylpropan-1-amine (PubChem CID 115861480) has the molecular formula C9H14BrNO3S and a molecular weight of 296.19 g/mol. Its IUPAC name is 1-(3-bromofuran-2-yl)-2-methyl-2-methylsulfonylpropan-1-amine.
| Compound Name | 1-(3-bromofuran-2-yl)-2-methyl-2-methylsulfonylpropan-1-amine |
|---|---|
| PubChem CID | 115861480 |
| Molecular Formula | C9H14BrNO3S |
| Molecular Weight | 296.19 g/mol |
| Exact Mass | 294.99 |
| IUPAC Name | 1-(3-bromofuran-2-yl)-2-methyl-2-methylsulfonylpropan-1-amine |
| SMILES | CC(C)(C(N)c1occc1Br)S(C)(=O)=O |
| InChI | InChI=1S/C9H14BrNO3S/c1-9(2,15(3,12)13)8(11)7-6(10)4-5-14-7/h4-5,8H,11H2,1-3H3 |
| InChIKey | YOTUACSHFJVLMX-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.19 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |