C16H24BrNO — CID 115862330
1-(2-bromo-5-methoxyphenyl)-4-cyclopentylbutan-2-amine (PubChem CID 115862330) has the molecular formula C16H24BrNO and a molecular weight of 326.28 g/mol. Its IUPAC name is 1-(2-bromo-5-methoxyphenyl)-4-cyclopentylbutan-2-amine.
| Compound Name | 1-(2-bromo-5-methoxyphenyl)-4-cyclopentylbutan-2-amine |
|---|---|
| PubChem CID | 115862330 |
| Molecular Formula | C16H24BrNO |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 1-(2-bromo-5-methoxyphenyl)-4-cyclopentylbutan-2-amine |
| SMILES | COc1ccc(Br)c(CC(N)CCC2CCCC2)c1 |
| InChI | InChI=1S/C16H24BrNO/c1-19-15-8-9-16(17)13(11-15)10-14(18)7-6-12-4-2-3-5-12/h8-9,11-12,14H,2-7,10,18H2,1H3 |
| InChIKey | UVNWYMYKHACINN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |