C9H12N2 — CID 11586323
1,2,3,4-tetrahydroisoquinolin-7-amine (PubChem CID 11586323) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 1,2,3,4-tetrahydroisoquinolin-7-amine.
| Compound Name | 1,2,3,4-tetrahydroisoquinolin-7-amine |
|---|---|
| PubChem CID | 11586323 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 1,2,3,4-tetrahydroisoquinolin-7-amine |
| SMILES | Nc1ccc2c(c1)CNCC2 |
| InChI | InChI=1S/C9H12N2/c10-9-2-1-7-3-4-11-6-8(7)5-9/h1-2,5,11H,3-4,6,10H2 |
| InChIKey | VMEDBFRQSKKEEQ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|