About thieno[3,2-d]pyrimidin-2-amine
thieno[3,2-d]pyrimidin-2-amine (PubChem CID 11586325) has the molecular formula C6H5N3S
and a molecular weight of 151.19 g/mol. Its IUPAC name is thieno[3,2-d]pyrimidin-2-amine.
Molecular Properties
| Compound Name | thieno[3,2-d]pyrimidin-2-amine |
| PubChem CID | 11586325 |
| Molecular Formula | C6H5N3S |
| Molecular Weight | 151.19 g/mol |
| Exact Mass | 151.02 |
| IUPAC Name | thieno[3,2-d]pyrimidin-2-amine |
| SMILES | Nc1ncc2sccc2n1 |
| InChI | InChI=1S/C6H5N3S/c7-6-8-3-5-4(9-6)1-2-10-5/h1-3H,(H2,7,8,9) |
| InChIKey | ZASCXWTVGGZQIZ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.19 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze thieno[3,2-d]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[3,2-d]pyrimidin-2-amine?
The IUPAC name of thieno[3,2-d]pyrimidin-2-amine (CID 11586325) is thieno[3,2-d]pyrimidin-2-amine.
What is the SMILES notation for thieno[3,2-d]pyrimidin-2-amine?
The canonical SMILES for thieno[3,2-d]pyrimidin-2-amine is Nc1ncc2sccc2n1.
What is the InChIKey of thieno[3,2-d]pyrimidin-2-amine?
The InChIKey is ZASCXWTVGGZQIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3S/c7-6-8-3-5-4(9-6)1-2-10-5/h1-3H,(H2,7,8,9).
What are the key properties of thieno[3,2-d]pyrimidin-2-amine?
thieno[3,2-d]pyrimidin-2-amine has a molecular weight of 151.19 g/mol, XLogP of 1.27, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[3,2-d]pyrimidin-2-amine is sourced from PubChem (CID 11586325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).