About (2R)-2-pyridin-2-yl-2,3-dihydropyran-4-one
(2R)-2-pyridin-2-yl-2,3-dihydropyran-4-one (PubChem CID 11586370) has the molecular formula C10H9NO2
and a molecular weight of 175.19 g/mol. Its IUPAC name is (2R)-2-pyridin-2-yl-2,3-dihydropyran-4-one.
Molecular Properties
| Compound Name | (2R)-2-pyridin-2-yl-2,3-dihydropyran-4-one |
| PubChem CID | 11586370 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | (2R)-2-pyridin-2-yl-2,3-dihydropyran-4-one |
| SMILES | O=C1C=CO[C@@H](c2ccccn2)C1 |
| InChI | InChI=1S/C10H9NO2/c12-8-4-6-13-10(7-8)9-3-1-2-5-11-9/h1-6,10H,7H2/t10-/m1/s1 |
| InChIKey | PDBCXFABXVMKQM-SNVBAGLBSA-N |
| XLogP | 1.63 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2-pyridin-2-yl-2,3-dihydropyran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-pyridin-2-yl-2,3-dihydropyran-4-one?
The IUPAC name of (2R)-2-pyridin-2-yl-2,3-dihydropyran-4-one (CID 11586370) is (2R)-2-pyridin-2-yl-2,3-dihydropyran-4-one.
What is the SMILES notation for (2R)-2-pyridin-2-yl-2,3-dihydropyran-4-one?
The canonical SMILES for (2R)-2-pyridin-2-yl-2,3-dihydropyran-4-one is O=C1C=CO[C@@H](c2ccccn2)C1.
What is the InChIKey of (2R)-2-pyridin-2-yl-2,3-dihydropyran-4-one?
The InChIKey is PDBCXFABXVMKQM-SNVBAGLBSA-N. The full InChI is InChI=1S/C10H9NO2/c12-8-4-6-13-10(7-8)9-3-1-2-5-11-9/h1-6,10H,7H2/t10-/m1/s1.
What are the key properties of (2R)-2-pyridin-2-yl-2,3-dihydropyran-4-one?
(2R)-2-pyridin-2-yl-2,3-dihydropyran-4-one has a molecular weight of 175.19 g/mol, XLogP of 1.63, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-pyridin-2-yl-2,3-dihydropyran-4-one is sourced from PubChem (CID 11586370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).