C16H17I2N — CID 115864070
N-ethyl-1,2-bis(4-iodophenyl)ethanamine (PubChem CID 115864070) has the molecular formula C16H17I2N and a molecular weight of 477.13 g/mol. Its IUPAC name is N-ethyl-1,2-bis(4-iodophenyl)ethanamine.
| Compound Name | N-ethyl-1,2-bis(4-iodophenyl)ethanamine |
|---|---|
| PubChem CID | 115864070 |
| Molecular Formula | C16H17I2N |
| Molecular Weight | 477.13 g/mol |
| Exact Mass | 476.95 |
| IUPAC Name | N-ethyl-1,2-bis(4-iodophenyl)ethanamine |
| SMILES | CCNC(Cc1ccc(I)cc1)c1ccc(I)cc1 |
| InChI | InChI=1S/C16H17I2N/c1-2-19-16(13-5-9-15(18)10-6-13)11-12-3-7-14(17)8-4-12/h3-10,16,19H,2,11H2,1H3 |
| InChIKey | PCIKWULNMPJAGR-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.13 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|