About 2-methyl-3-pentyl-1,3-thiazolidin-4-one
2-methyl-3-pentyl-1,3-thiazolidin-4-one (PubChem CID 11586417) has the molecular formula C9H17NOS
and a molecular weight of 187.31 g/mol. Its IUPAC name is 2-methyl-3-pentyl-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 2-methyl-3-pentyl-1,3-thiazolidin-4-one |
| PubChem CID | 11586417 |
| Molecular Formula | C9H17NOS |
| Molecular Weight | 187.31 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 2-methyl-3-pentyl-1,3-thiazolidin-4-one |
| SMILES | CCCCCN1C(=O)CSC1C |
| InChI | InChI=1S/C9H17NOS/c1-3-4-5-6-10-8(2)12-7-9(10)11/h8H,3-7H2,1-2H3 |
| InChIKey | DFLVXJUNILXKKD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3-pentyl-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-pentyl-1,3-thiazolidin-4-one?
The IUPAC name of 2-methyl-3-pentyl-1,3-thiazolidin-4-one (CID 11586417) is 2-methyl-3-pentyl-1,3-thiazolidin-4-one.
What is the SMILES notation for 2-methyl-3-pentyl-1,3-thiazolidin-4-one?
The canonical SMILES for 2-methyl-3-pentyl-1,3-thiazolidin-4-one is CCCCCN1C(=O)CSC1C.
What is the InChIKey of 2-methyl-3-pentyl-1,3-thiazolidin-4-one?
The InChIKey is DFLVXJUNILXKKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NOS/c1-3-4-5-6-10-8(2)12-7-9(10)11/h8H,3-7H2,1-2H3.
What are the key properties of 2-methyl-3-pentyl-1,3-thiazolidin-4-one?
2-methyl-3-pentyl-1,3-thiazolidin-4-one has a molecular weight of 187.31 g/mol, XLogP of 2.10, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-pentyl-1,3-thiazolidin-4-one is sourced from PubChem (CID 11586417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).