C18H22INO — CID 115864174
N-ethyl-2-(4-iodophenyl)-1-(2-methoxy-5-methylphenyl)ethanamine (PubChem CID 115864174) has the molecular formula C18H22INO and a molecular weight of 395.28 g/mol. Its IUPAC name is N-ethyl-2-(4-iodophenyl)-1-(2-methoxy-5-methylphenyl)ethanamine.
| Compound Name | N-ethyl-2-(4-iodophenyl)-1-(2-methoxy-5-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 115864174 |
| Molecular Formula | C18H22INO |
| Molecular Weight | 395.28 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | N-ethyl-2-(4-iodophenyl)-1-(2-methoxy-5-methylphenyl)ethanamine |
| SMILES | CCNC(Cc1ccc(I)cc1)c1cc(C)ccc1OC |
| InChI | InChI=1S/C18H22INO/c1-4-20-17(12-14-6-8-15(19)9-7-14)16-11-13(2)5-10-18(16)21-3/h5-11,17,20H,4,12H2,1-3H3 |
| InChIKey | FSKSDRHCPNSTHA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.28 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|