C15H14Cl2IN — CID 115864231
1-(2,4-dichlorophenyl)-2-(4-iodophenyl)-N-methylethanamine (PubChem CID 115864231) has the molecular formula C15H14Cl2IN and a molecular weight of 406.09 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-2-(4-iodophenyl)-N-methylethanamine.
| Compound Name | 1-(2,4-dichlorophenyl)-2-(4-iodophenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 115864231 |
| Molecular Formula | C15H14Cl2IN |
| Molecular Weight | 406.09 g/mol |
| Exact Mass | 404.95 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-2-(4-iodophenyl)-N-methylethanamine |
| SMILES | CNC(Cc1ccc(I)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H14Cl2IN/c1-19-15(8-10-2-5-12(18)6-3-10)13-7-4-11(16)9-14(13)17/h2-7,9,15,19H,8H2,1H3 |
| InChIKey | KPKLOMOBTVSSIJ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.09 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|