About (3R)-3-butylthiazinane 1,1-dioxide
(3R)-3-butylthiazinane 1,1-dioxide (PubChem CID 11586429) has the molecular formula C8H17NO2S
and a molecular weight of 191.30 g/mol. Its IUPAC name is (3R)-3-butylthiazinane 1,1-dioxide.
Molecular Properties
| Compound Name | (3R)-3-butylthiazinane 1,1-dioxide |
| PubChem CID | 11586429 |
| Molecular Formula | C8H17NO2S |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.10 |
| IUPAC Name | (3R)-3-butylthiazinane 1,1-dioxide |
| SMILES | CCCC[C@@H]1CCCS(=O)(=O)N1 |
| InChI | InChI=1S/C8H17NO2S/c1-2-3-5-8-6-4-7-12(10,11)9-8/h8-9H,2-7H2,1H3/t8-/m1/s1 |
| InChIKey | VLIPXIATUMSWBM-MRVPVSSYSA-N |
| XLogP | 1.26 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-3-butylthiazinane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-butylthiazinane 1,1-dioxide?
The IUPAC name of (3R)-3-butylthiazinane 1,1-dioxide (CID 11586429) is (3R)-3-butylthiazinane 1,1-dioxide.
What is the SMILES notation for (3R)-3-butylthiazinane 1,1-dioxide?
The canonical SMILES for (3R)-3-butylthiazinane 1,1-dioxide is CCCC[C@@H]1CCCS(=O)(=O)N1.
What is the InChIKey of (3R)-3-butylthiazinane 1,1-dioxide?
The InChIKey is VLIPXIATUMSWBM-MRVPVSSYSA-N. The full InChI is InChI=1S/C8H17NO2S/c1-2-3-5-8-6-4-7-12(10,11)9-8/h8-9H,2-7H2,1H3/t8-/m1/s1.
What are the key properties of (3R)-3-butylthiazinane 1,1-dioxide?
(3R)-3-butylthiazinane 1,1-dioxide has a molecular weight of 191.30 g/mol, XLogP of 1.26, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-butylthiazinane 1,1-dioxide is sourced from PubChem (CID 11586429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).