C15H13BrF2IN — CID 115864305
1-(4-bromo-2,6-difluorophenyl)-2-(4-iodophenyl)-N-methylethanamine (PubChem CID 115864305) has the molecular formula C15H13BrF2IN and a molecular weight of 452.08 g/mol. Its IUPAC name is 1-(4-bromo-2,6-difluorophenyl)-2-(4-iodophenyl)-N-methylethanamine.
| Compound Name | 1-(4-bromo-2,6-difluorophenyl)-2-(4-iodophenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 115864305 |
| Molecular Formula | C15H13BrF2IN |
| Molecular Weight | 452.08 g/mol |
| Exact Mass | 450.92 |
| IUPAC Name | 1-(4-bromo-2,6-difluorophenyl)-2-(4-iodophenyl)-N-methylethanamine |
| SMILES | CNC(Cc1ccc(I)cc1)c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C15H13BrF2IN/c1-20-14(6-9-2-4-11(19)5-3-9)15-12(17)7-10(16)8-13(15)18/h2-5,7-8,14,20H,6H2,1H3 |
| InChIKey | KYQBVIFHYYHDIW-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.08 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|