C11H14O3 — CID 11586438
3,8,8-trimethyl-2,5-dihydrofuro[3,4-b]oxepin-6-one (PubChem CID 11586438) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is 3,8,8-trimethyl-2,5-dihydrofuro[3,4-b]oxepin-6-one.
| Compound Name | 3,8,8-trimethyl-2,5-dihydrofuro[3,4-b]oxepin-6-one |
|---|---|
| PubChem CID | 11586438 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 3,8,8-trimethyl-2,5-dihydrofuro[3,4-b]oxepin-6-one |
| SMILES | CC1=CCC2=C(OC1)C(C)(C)OC2=O |
| InChI | InChI=1S/C11H14O3/c1-7-4-5-8-9(13-6-7)11(2,3)14-10(8)12/h4H,5-6H2,1-3H3 |
| InChIKey | FFVZDRODVLDXOY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|