C17H20INS — CID 115864397
1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-N-ethyl-2-(4-iodophenyl)ethanamine (PubChem CID 115864397) has the molecular formula C17H20INS and a molecular weight of 397.33 g/mol. Its IUPAC name is 1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-N-ethyl-2-(4-iodophenyl)ethanamine.
| Compound Name | 1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-N-ethyl-2-(4-iodophenyl)ethanamine |
|---|---|
| PubChem CID | 115864397 |
| Molecular Formula | C17H20INS |
| Molecular Weight | 397.33 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | 1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-N-ethyl-2-(4-iodophenyl)ethanamine |
| SMILES | CCNC(Cc1ccc(I)cc1)c1cc2c(s1)CCC2 |
| InChI | InChI=1S/C17H20INS/c1-2-19-15(10-12-6-8-14(18)9-7-12)17-11-13-4-3-5-16(13)20-17/h6-9,11,15,19H,2-5,10H2,1H3 |
| InChIKey | NKGSMPLBGPLYGC-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.33 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|