C13H20Si — CID 11586488
trimethyl-[(1R,2R,5S,6S)-7-tricyclo[4.2.2.02,5]deca-7,9-dienyl]silane (PubChem CID 11586488) has the molecular formula C13H20Si and a molecular weight of 204.39 g/mol. Its IUPAC name is trimethyl-[(1R,2R,5S,6S)-7-tricyclo[4.2.2.02,5]deca-7,9-dienyl]silane.
| Compound Name | trimethyl-[(1R,2R,5S,6S)-7-tricyclo[4.2.2.02,5]deca-7,9-dienyl]silane |
|---|---|
| PubChem CID | 11586488 |
| Molecular Formula | C13H20Si |
| Molecular Weight | 204.39 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | trimethyl-[(1R,2R,5S,6S)-7-tricyclo[4.2.2.02,5]deca-7,9-dienyl]silane |
| SMILES | C[Si](C)(C)C1=C[C@@H]2C=C[C@H]1[C@H]1CC[C@@H]21 |
| InChI | InChI=1S/C13H20Si/c1-14(2,3)13-8-9-4-5-12(13)11-7-6-10(9)11/h4-5,8-12H,6-7H2,1-3H3/t9-,10-,11-,12-/m0/s1 |
| InChIKey | JIIULFWOPRUUIR-BJDJZHNGSA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|