C5H5F7O — CID 11586547
1-ethoxy-1,1,2,2,3,3,3-heptafluoropropane (PubChem CID 11586547) has the molecular formula C5H5F7O and a molecular weight of 214.08 g/mol. Its IUPAC name is 1-ethoxy-1,1,2,2,3,3,3-heptafluoropropane.
| Compound Name | 1-ethoxy-1,1,2,2,3,3,3-heptafluoropropane |
|---|---|
| PubChem CID | 11586547 |
| Molecular Formula | C5H5F7O |
| Molecular Weight | 214.08 g/mol |
| Exact Mass | 214.02 |
| IUPAC Name | 1-ethoxy-1,1,2,2,3,3,3-heptafluoropropane |
| SMILES | CCOC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H5F7O/c1-2-13-5(11,12)3(6,7)4(8,9)10/h2H2,1H3 |
| InChIKey | HNQMKNFMSPECFD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.08 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|