About 6-piperazin-1-yl-7,9-dihydropurin-8-one
6-piperazin-1-yl-7,9-dihydropurin-8-one (PubChem CID 11586587) has the molecular formula C9H12N6O
and a molecular weight of 220.24 g/mol. Its IUPAC name is 6-piperazin-1-yl-7,9-dihydropurin-8-one.
Molecular Properties
| Compound Name | 6-piperazin-1-yl-7,9-dihydropurin-8-one |
| PubChem CID | 11586587 |
| Molecular Formula | C9H12N6O |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 6-piperazin-1-yl-7,9-dihydropurin-8-one |
| SMILES | O=c1[nH]c2ncnc(N3CCNCC3)c2[nH]1 |
| InChI | InChI=1S/C9H12N6O/c16-9-13-6-7(14-9)11-5-12-8(6)15-3-1-10-2-4-15/h5,10H,1-4H2,(H2,11,12,13,14,16) |
| InChIKey | FCNPNXKAOVZNPK-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-piperazin-1-yl-7,9-dihydropurin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-piperazin-1-yl-7,9-dihydropurin-8-one?
The IUPAC name of 6-piperazin-1-yl-7,9-dihydropurin-8-one (CID 11586587) is 6-piperazin-1-yl-7,9-dihydropurin-8-one.
What is the SMILES notation for 6-piperazin-1-yl-7,9-dihydropurin-8-one?
The canonical SMILES for 6-piperazin-1-yl-7,9-dihydropurin-8-one is O=c1[nH]c2ncnc(N3CCNCC3)c2[nH]1.
What is the InChIKey of 6-piperazin-1-yl-7,9-dihydropurin-8-one?
The InChIKey is FCNPNXKAOVZNPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N6O/c16-9-13-6-7(14-9)11-5-12-8(6)15-3-1-10-2-4-15/h5,10H,1-4H2,(H2,11,12,13,14,16).
What are the key properties of 6-piperazin-1-yl-7,9-dihydropurin-8-one?
6-piperazin-1-yl-7,9-dihydropurin-8-one has a molecular weight of 220.24 g/mol, XLogP of -0.94, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-piperazin-1-yl-7,9-dihydropurin-8-one is sourced from PubChem (CID 11586587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).