C12H20O4 — CID 11586656
ethyl (E,4S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-2-enoate (PubChem CID 11586656) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is ethyl (E,4S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-2-enoate.
| Compound Name | ethyl (E,4S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-2-enoate |
|---|---|
| PubChem CID | 11586656 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | ethyl (E,4S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C12H20O4/c1-5-14-11(13)7-6-9(2)10-8-15-12(3,4)16-10/h6-7,9-10H,5,8H2,1-4H3/b7-6+/t9-,10+/m0/s1 |
| InChIKey | BXTDYXUOSPCKDP-LOSXEJPUSA-N |
| XLogP | 1.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|