About 1,6-dimethyl-2-(triazol-2-yl)imidazo[4,5-c]pyridin-4-amine
1,6-dimethyl-2-(triazol-2-yl)imidazo[4,5-c]pyridin-4-amine (PubChem CID 11586663) has the molecular formula C10H11N7
and a molecular weight of 229.25 g/mol. Its IUPAC name is 1,6-dimethyl-2-(triazol-2-yl)imidazo[4,5-c]pyridin-4-amine.
Molecular Properties
| Compound Name | 1,6-dimethyl-2-(triazol-2-yl)imidazo[4,5-c]pyridin-4-amine |
| PubChem CID | 11586663 |
| Molecular Formula | C10H11N7 |
| Molecular Weight | 229.25 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 1,6-dimethyl-2-(triazol-2-yl)imidazo[4,5-c]pyridin-4-amine |
| SMILES | Cc1cc2c(nc(-n3nccn3)n2C)c(N)n1 |
| InChI | InChI=1S/C10H11N7/c1-6-5-7-8(9(11)14-6)15-10(16(7)2)17-12-3-4-13-17/h3-5H,1-2H3,(H2,11,14) |
| InChIKey | HQJPRTMRYHJULG-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.25 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1,6-dimethyl-2-(triazol-2-yl)imidazo[4,5-c]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dimethyl-2-(triazol-2-yl)imidazo[4,5-c]pyridin-4-amine?
The IUPAC name of 1,6-dimethyl-2-(triazol-2-yl)imidazo[4,5-c]pyridin-4-amine (CID 11586663) is 1,6-dimethyl-2-(triazol-2-yl)imidazo[4,5-c]pyridin-4-amine.
What is the SMILES notation for 1,6-dimethyl-2-(triazol-2-yl)imidazo[4,5-c]pyridin-4-amine?
The canonical SMILES for 1,6-dimethyl-2-(triazol-2-yl)imidazo[4,5-c]pyridin-4-amine is Cc1cc2c(nc(-n3nccn3)n2C)c(N)n1.
What is the InChIKey of 1,6-dimethyl-2-(triazol-2-yl)imidazo[4,5-c]pyridin-4-amine?
The InChIKey is HQJPRTMRYHJULG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N7/c1-6-5-7-8(9(11)14-6)15-10(16(7)2)17-12-3-4-13-17/h3-5H,1-2H3,(H2,11,14).
What are the key properties of 1,6-dimethyl-2-(triazol-2-yl)imidazo[4,5-c]pyridin-4-amine?
1,6-dimethyl-2-(triazol-2-yl)imidazo[4,5-c]pyridin-4-amine has a molecular weight of 229.25 g/mol, XLogP of 0.44, 1 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dimethyl-2-(triazol-2-yl)imidazo[4,5-c]pyridin-4-amine is sourced from PubChem (CID 11586663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).