C10H21NO3S — CID 115867671
N-[(1-hydroxycyclopentyl)methyl]-N-methylpropane-2-sulfonamide (PubChem CID 115867671) has the molecular formula C10H21NO3S and a molecular weight of 235.35 g/mol. Its IUPAC name is N-[(1-hydroxycyclopentyl)methyl]-N-methylpropane-2-sulfonamide.
| Compound Name | N-[(1-hydroxycyclopentyl)methyl]-N-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 115867671 |
| Molecular Formula | C10H21NO3S |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | N-[(1-hydroxycyclopentyl)methyl]-N-methylpropane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)N(C)CC1(O)CCCC1 |
| InChI | InChI=1S/C10H21NO3S/c1-9(2)15(13,14)11(3)8-10(12)6-4-5-7-10/h9,12H,4-8H2,1-3H3 |
| InChIKey | JJLSRKPTDJQYOB-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |