About N-(2-formyl-5,8-dioxoquinolin-7-yl)acetamide
N-(2-formyl-5,8-dioxoquinolin-7-yl)acetamide (PubChem CID 11586798) has the molecular formula C12H8N2O4
and a molecular weight of 244.21 g/mol. Its IUPAC name is N-(2-formyl-5,8-dioxoquinolin-7-yl)acetamide.
Molecular Properties
| Compound Name | N-(2-formyl-5,8-dioxoquinolin-7-yl)acetamide |
| PubChem CID | 11586798 |
| Molecular Formula | C12H8N2O4 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | N-(2-formyl-5,8-dioxoquinolin-7-yl)acetamide |
| SMILES | CC(=O)NC1=CC(=O)c2ccc(C=O)nc2C1=O |
| InChI | InChI=1S/C12H8N2O4/c1-6(16)13-9-4-10(17)8-3-2-7(5-15)14-11(8)12(9)18/h2-5H,1H3,(H,13,16) |
| InChIKey | WPDTVUVXWYWPKA-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(2-formyl-5,8-dioxoquinolin-7-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-formyl-5,8-dioxoquinolin-7-yl)acetamide?
The IUPAC name of N-(2-formyl-5,8-dioxoquinolin-7-yl)acetamide (CID 11586798) is N-(2-formyl-5,8-dioxoquinolin-7-yl)acetamide.
What is the SMILES notation for N-(2-formyl-5,8-dioxoquinolin-7-yl)acetamide?
The canonical SMILES for N-(2-formyl-5,8-dioxoquinolin-7-yl)acetamide is CC(=O)NC1=CC(=O)c2ccc(C=O)nc2C1=O.
What is the InChIKey of N-(2-formyl-5,8-dioxoquinolin-7-yl)acetamide?
The InChIKey is WPDTVUVXWYWPKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O4/c1-6(16)13-9-4-10(17)8-3-2-7(5-15)14-11(8)12(9)18/h2-5H,1H3,(H,13,16).
What are the key properties of N-(2-formyl-5,8-dioxoquinolin-7-yl)acetamide?
N-(2-formyl-5,8-dioxoquinolin-7-yl)acetamide has a molecular weight of 244.21 g/mol, XLogP of 0.29, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-formyl-5,8-dioxoquinolin-7-yl)acetamide is sourced from PubChem (CID 11586798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).