About (5R)-3,5-diethyl-5-[(E,2R)-2-ethylhex-3-enyl]furan-2-one
(5R)-3,5-diethyl-5-[(E,2R)-2-ethylhex-3-enyl]furan-2-one (PubChem CID 11586873) has the molecular formula C16H26O2
and a molecular weight of 250.38 g/mol. Its IUPAC name is (5R)-3,5-diethyl-5-[(E,2R)-2-ethylhex-3-enyl]furan-2-one.
Molecular Properties
| Compound Name | (5R)-3,5-diethyl-5-[(E,2R)-2-ethylhex-3-enyl]furan-2-one |
| PubChem CID | 11586873 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | (5R)-3,5-diethyl-5-[(E,2R)-2-ethylhex-3-enyl]furan-2-one |
| SMILES | CC/C=C/[C@H](CC)C[C@]1(CC)C=C(CC)C(=O)O1 |
| InChI | InChI=1S/C16H26O2/c1-5-9-10-13(6-2)11-16(8-4)12-14(7-3)15(17)18-16/h9-10,12-13H,5-8,11H2,1-4H3/b10-9+/t13-,16+/m0/s1 |
| InChIKey | LTZNAWIQNGLESM-SSBZQZJYSA-N |
| XLogP | 4.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5R)-3,5-diethyl-5-[(E,2R)-2-ethylhex-3-enyl]furan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-3,5-diethyl-5-[(E,2R)-2-ethylhex-3-enyl]furan-2-one?
The IUPAC name of (5R)-3,5-diethyl-5-[(E,2R)-2-ethylhex-3-enyl]furan-2-one (CID 11586873) is (5R)-3,5-diethyl-5-[(E,2R)-2-ethylhex-3-enyl]furan-2-one.
What is the SMILES notation for (5R)-3,5-diethyl-5-[(E,2R)-2-ethylhex-3-enyl]furan-2-one?
The canonical SMILES for (5R)-3,5-diethyl-5-[(E,2R)-2-ethylhex-3-enyl]furan-2-one is CC/C=C/[C@H](CC)C[C@]1(CC)C=C(CC)C(=O)O1.
What is the InChIKey of (5R)-3,5-diethyl-5-[(E,2R)-2-ethylhex-3-enyl]furan-2-one?
The InChIKey is LTZNAWIQNGLESM-SSBZQZJYSA-N. The full InChI is InChI=1S/C16H26O2/c1-5-9-10-13(6-2)11-16(8-4)12-14(7-3)15(17)18-16/h9-10,12-13H,5-8,11H2,1-4H3/b10-9+/t13-,16+/m0/s1.
What are the key properties of (5R)-3,5-diethyl-5-[(E,2R)-2-ethylhex-3-enyl]furan-2-one?
(5R)-3,5-diethyl-5-[(E,2R)-2-ethylhex-3-enyl]furan-2-one has a molecular weight of 250.38 g/mol, XLogP of 4.41, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-3,5-diethyl-5-[(E,2R)-2-ethylhex-3-enyl]furan-2-one is sourced from PubChem (CID 11586873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).