C13H16N2O — CID 11586894
(3aS,9bR)-6,8-dimethyl-1,2,3,3a,4,9b-hexahydropyrrolo[3,4-c]isoquinolin-5-one (PubChem CID 11586894) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is (3aS,9bR)-6,8-dimethyl-1,2,3,3a,4,9b-hexahydropyrrolo[3,4-c]isoquinolin-5-one.
| Compound Name | (3aS,9bR)-6,8-dimethyl-1,2,3,3a,4,9b-hexahydropyrrolo[3,4-c]isoquinolin-5-one |
|---|---|
| PubChem CID | 11586894 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | (3aS,9bR)-6,8-dimethyl-1,2,3,3a,4,9b-hexahydropyrrolo[3,4-c]isoquinolin-5-one |
| SMILES | Cc1cc(C)c2c(c1)[C@@H]1CNC[C@H]1NC2=O |
| InChI | InChI=1S/C13H16N2O/c1-7-3-8(2)12-9(4-7)10-5-14-6-11(10)15-13(12)16/h3-4,10-11,14H,5-6H2,1-2H3,(H,15,16)/t10-,11+/m0/s1 |
| InChIKey | SGPNLBSMFCLLAE-WDEREUQCSA-N |
| XLogP | 1.10 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |