C11H11FN2O — CID 115869130
6-fluoro-N-pent-4-yn-2-ylpyridine-2-carboxamide (PubChem CID 115869130) has the molecular formula C11H11FN2O and a molecular weight of 206.22 g/mol. Its IUPAC name is 6-fluoro-N-pent-4-yn-2-ylpyridine-2-carboxamide.
| Compound Name | 6-fluoro-N-pent-4-yn-2-ylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 115869130 |
| Molecular Formula | C11H11FN2O |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 6-fluoro-N-pent-4-yn-2-ylpyridine-2-carboxamide |
| SMILES | C#CCC(C)NC(=O)c1cccc(F)n1 |
| InChI | InChI=1S/C11H11FN2O/c1-3-5-8(2)13-11(15)9-6-4-7-10(12)14-9/h1,4,6-8H,5H2,2H3,(H,13,15) |
| InChIKey | OCTCFYBOCJPFBS-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|