About 5-(bromoamino)-2,3-dihydrophthalazine-1,4-dione
5-(bromoamino)-2,3-dihydrophthalazine-1,4-dione (PubChem CID 11586922) has the molecular formula C8H6BrN3O2
and a molecular weight of 256.06 g/mol. Its IUPAC name is 5-(bromoamino)-2,3-dihydrophthalazine-1,4-dione.
Molecular Properties
| Compound Name | 5-(bromoamino)-2,3-dihydrophthalazine-1,4-dione |
| PubChem CID | 11586922 |
| Molecular Formula | C8H6BrN3O2 |
| Molecular Weight | 256.06 g/mol |
| Exact Mass | 254.96 |
| IUPAC Name | 5-(bromoamino)-2,3-dihydrophthalazine-1,4-dione |
| SMILES | O=c1[nH][nH]c(=O)c2c(NBr)cccc12 |
| InChI | InChI=1S/C8H6BrN3O2/c9-10-5-3-1-2-4-6(5)8(14)12-11-7(4)13/h1-3,10H,(H,11,13)(H,12,14) |
| InChIKey | NCGIKGCLUWXKTP-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.06 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 5-(bromoamino)-2,3-dihydrophthalazine-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(bromoamino)-2,3-dihydrophthalazine-1,4-dione?
The IUPAC name of 5-(bromoamino)-2,3-dihydrophthalazine-1,4-dione (CID 11586922) is 5-(bromoamino)-2,3-dihydrophthalazine-1,4-dione.
What is the SMILES notation for 5-(bromoamino)-2,3-dihydrophthalazine-1,4-dione?
The canonical SMILES for 5-(bromoamino)-2,3-dihydrophthalazine-1,4-dione is O=c1[nH][nH]c(=O)c2c(NBr)cccc12.
What is the InChIKey of 5-(bromoamino)-2,3-dihydrophthalazine-1,4-dione?
The InChIKey is NCGIKGCLUWXKTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrN3O2/c9-10-5-3-1-2-4-6(5)8(14)12-11-7(4)13/h1-3,10H,(H,11,13)(H,12,14).
What are the key properties of 5-(bromoamino)-2,3-dihydrophthalazine-1,4-dione?
5-(bromoamino)-2,3-dihydrophthalazine-1,4-dione has a molecular weight of 256.06 g/mol, XLogP of 0.94, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(bromoamino)-2,3-dihydrophthalazine-1,4-dione is sourced from PubChem (CID 11586922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).