About 3-cyclohexyl-1,5-dioxaspiro[5.5]undecane-2,4-dione
3-cyclohexyl-1,5-dioxaspiro[5.5]undecane-2,4-dione (PubChem CID 11587045) has the molecular formula C15H22O4
and a molecular weight of 266.34 g/mol. Its IUPAC name is 3-cyclohexyl-1,5-dioxaspiro[5.5]undecane-2,4-dione.
Molecular Properties
| Compound Name | 3-cyclohexyl-1,5-dioxaspiro[5.5]undecane-2,4-dione |
| PubChem CID | 11587045 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 3-cyclohexyl-1,5-dioxaspiro[5.5]undecane-2,4-dione |
| SMILES | O=C1OC2(CCCCC2)OC(=O)C1C1CCCCC1 |
| InChI | InChI=1S/C15H22O4/c16-13-12(11-7-3-1-4-8-11)14(17)19-15(18-13)9-5-2-6-10-15/h11-12H,1-10H2 |
| InChIKey | ZXFAOYLGEIBCHO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclohexyl-1,5-dioxaspiro[5.5]undecane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-1,5-dioxaspiro[5.5]undecane-2,4-dione?
The IUPAC name of 3-cyclohexyl-1,5-dioxaspiro[5.5]undecane-2,4-dione (CID 11587045) is 3-cyclohexyl-1,5-dioxaspiro[5.5]undecane-2,4-dione.
What is the SMILES notation for 3-cyclohexyl-1,5-dioxaspiro[5.5]undecane-2,4-dione?
The canonical SMILES for 3-cyclohexyl-1,5-dioxaspiro[5.5]undecane-2,4-dione is O=C1OC2(CCCCC2)OC(=O)C1C1CCCCC1.
What is the InChIKey of 3-cyclohexyl-1,5-dioxaspiro[5.5]undecane-2,4-dione?
The InChIKey is ZXFAOYLGEIBCHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O4/c16-13-12(11-7-3-1-4-8-11)14(17)19-15(18-13)9-5-2-6-10-15/h11-12H,1-10H2.
What are the key properties of 3-cyclohexyl-1,5-dioxaspiro[5.5]undecane-2,4-dione?
3-cyclohexyl-1,5-dioxaspiro[5.5]undecane-2,4-dione has a molecular weight of 266.34 g/mol, XLogP of 2.94, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-1,5-dioxaspiro[5.5]undecane-2,4-dione is sourced from PubChem (CID 11587045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).