C12H22N2O2 — CID 115871728
3,4-dimethyl-N-(oxolan-3-yl)piperidine-1-carboxamide (PubChem CID 115871728) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 3,4-dimethyl-N-(oxolan-3-yl)piperidine-1-carboxamide.
| Compound Name | 3,4-dimethyl-N-(oxolan-3-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 115871728 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 3,4-dimethyl-N-(oxolan-3-yl)piperidine-1-carboxamide |
| SMILES | CC1CCN(C(=O)NC2CCOC2)CC1C |
| InChI | InChI=1S/C12H22N2O2/c1-9-3-5-14(7-10(9)2)12(15)13-11-4-6-16-8-11/h9-11H,3-8H2,1-2H3,(H,13,15) |
| InChIKey | QGGNFIAISCIBKV-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |