About 1-[(3S,6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]-4-trimethylsilylbut-3-yn-2-one
1-[(3S,6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]-4-trimethylsilylbut-3-yn-2-one (PubChem CID 11587194) has the molecular formula C17H28OSi
and a molecular weight of 276.50 g/mol. Its IUPAC name is 1-[(3S,6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]-4-trimethylsilylbut-3-yn-2-one.
Molecular Properties
| Compound Name | 1-[(3S,6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]-4-trimethylsilylbut-3-yn-2-one |
| PubChem CID | 11587194 |
| Molecular Formula | C17H28OSi |
| Molecular Weight | 276.50 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | 1-[(3S,6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]-4-trimethylsilylbut-3-yn-2-one |
| SMILES | CC(C)[C@H]1C=C(CC(=O)C#C[Si](C)(C)C)[C@H](C)CC1 |
| InChI | InChI=1S/C17H28OSi/c1-13(2)15-8-7-14(3)16(11-15)12-17(18)9-10-19(4,5)6/h11,13-15H,7-8,12H2,1-6H3/t14-,15-/m1/s1 |
| InChIKey | ZDQMNVCNMOMEHN-HUUCEWRRSA-N |
| XLogP | 4.45 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3S,6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]-4-trimethylsilylbut-3-yn-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S,6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]-4-trimethylsilylbut-3-yn-2-one?
The IUPAC name of 1-[(3S,6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]-4-trimethylsilylbut-3-yn-2-one (CID 11587194) is 1-[(3S,6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]-4-trimethylsilylbut-3-yn-2-one.
What is the SMILES notation for 1-[(3S,6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]-4-trimethylsilylbut-3-yn-2-one?
The canonical SMILES for 1-[(3S,6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]-4-trimethylsilylbut-3-yn-2-one is CC(C)[C@H]1C=C(CC(=O)C#C[Si](C)(C)C)[C@H](C)CC1.
What is the InChIKey of 1-[(3S,6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]-4-trimethylsilylbut-3-yn-2-one?
The InChIKey is ZDQMNVCNMOMEHN-HUUCEWRRSA-N. The full InChI is InChI=1S/C17H28OSi/c1-13(2)15-8-7-14(3)16(11-15)12-17(18)9-10-19(4,5)6/h11,13-15H,7-8,12H2,1-6H3/t14-,15-/m1/s1.
What are the key properties of 1-[(3S,6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]-4-trimethylsilylbut-3-yn-2-one?
1-[(3S,6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]-4-trimethylsilylbut-3-yn-2-one has a molecular weight of 276.50 g/mol, XLogP of 4.45, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S,6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]-4-trimethylsilylbut-3-yn-2-one is sourced from PubChem (CID 11587194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).