C15H20N2O2S — CID 115872304
2-[4-(3,4-dimethylpiperidin-1-yl)sulfonylphenyl]acetonitrile (PubChem CID 115872304) has the molecular formula C15H20N2O2S and a molecular weight of 292.40 g/mol. Its IUPAC name is 2-[4-(3,4-dimethylpiperidin-1-yl)sulfonylphenyl]acetonitrile.
| Compound Name | 2-[4-(3,4-dimethylpiperidin-1-yl)sulfonylphenyl]acetonitrile |
|---|---|
| PubChem CID | 115872304 |
| Molecular Formula | C15H20N2O2S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 2-[4-(3,4-dimethylpiperidin-1-yl)sulfonylphenyl]acetonitrile |
| SMILES | CC1CCN(S(=O)(=O)c2ccc(CC#N)cc2)CC1C |
| InChI | InChI=1S/C15H20N2O2S/c1-12-8-10-17(11-13(12)2)20(18,19)15-5-3-14(4-6-15)7-9-16/h3-6,12-13H,7-8,10-11H2,1-2H3 |
| InChIKey | DSKIFLXNHOYONG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |