C10H17N3O3S — CID 115872482
3-methyl-1-[(5-methyl-1H-pyrazol-4-yl)sulfonyl]piperidin-3-ol (PubChem CID 115872482) has the molecular formula C10H17N3O3S and a molecular weight of 259.33 g/mol. Its IUPAC name is 3-methyl-1-[(5-methyl-1H-pyrazol-4-yl)sulfonyl]piperidin-3-ol.
| Compound Name | 3-methyl-1-[(5-methyl-1H-pyrazol-4-yl)sulfonyl]piperidin-3-ol |
|---|---|
| PubChem CID | 115872482 |
| Molecular Formula | C10H17N3O3S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 3-methyl-1-[(5-methyl-1H-pyrazol-4-yl)sulfonyl]piperidin-3-ol |
| SMILES | Cc1[nH]ncc1S(=O)(=O)N1CCCC(C)(O)C1 |
| InChI | InChI=1S/C10H17N3O3S/c1-8-9(6-11-12-8)17(15,16)13-5-3-4-10(2,14)7-13/h6,14H,3-5,7H2,1-2H3,(H,11,12) |
| InChIKey | WQNOXOIHZOZCKY-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |