About (NE)-N-[2-(1,3-benzodioxol-5-yl)-3-cyclopentylcyclopent-2-en-1-ylidene]hydroxylamine
(NE)-N-[2-(1,3-benzodioxol-5-yl)-3-cyclopentylcyclopent-2-en-1-ylidene]hydroxylamine (PubChem CID 11587302) has the molecular formula C17H19NO3
and a molecular weight of 285.34 g/mol. Its IUPAC name is (NE)-N-[2-(1,3-benzodioxol-5-yl)-3-cyclopentylcyclopent-2-en-1-ylidene]hydroxylamine.
Molecular Properties
| Compound Name | (NE)-N-[2-(1,3-benzodioxol-5-yl)-3-cyclopentylcyclopent-2-en-1-ylidene]hydroxylamine |
| PubChem CID | 11587302 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | (NE)-N-[2-(1,3-benzodioxol-5-yl)-3-cyclopentylcyclopent-2-en-1-ylidene]hydroxylamine |
| SMILES | O/N=C1\CCC(C2CCCC2)=C1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H19NO3/c19-18-14-7-6-13(11-3-1-2-4-11)17(14)12-5-8-15-16(9-12)21-10-20-15/h5,8-9,11,19H,1-4,6-7,10H2/b18-14+ |
| InChIKey | MMAUSJFVJCPIPA-NBVRZTHBSA-N |
| XLogP | 3.98 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-[2-(1,3-benzodioxol-5-yl)-3-cyclopentylcyclopent-2-en-1-ylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-[2-(1,3-benzodioxol-5-yl)-3-cyclopentylcyclopent-2-en-1-ylidene]hydroxylamine?
The IUPAC name of (NE)-N-[2-(1,3-benzodioxol-5-yl)-3-cyclopentylcyclopent-2-en-1-ylidene]hydroxylamine (CID 11587302) is (NE)-N-[2-(1,3-benzodioxol-5-yl)-3-cyclopentylcyclopent-2-en-1-ylidene]hydroxylamine.
What is the SMILES notation for (NE)-N-[2-(1,3-benzodioxol-5-yl)-3-cyclopentylcyclopent-2-en-1-ylidene]hydroxylamine?
The canonical SMILES for (NE)-N-[2-(1,3-benzodioxol-5-yl)-3-cyclopentylcyclopent-2-en-1-ylidene]hydroxylamine is O/N=C1\CCC(C2CCCC2)=C1c1ccc2c(c1)OCO2.
What is the InChIKey of (NE)-N-[2-(1,3-benzodioxol-5-yl)-3-cyclopentylcyclopent-2-en-1-ylidene]hydroxylamine?
The InChIKey is MMAUSJFVJCPIPA-NBVRZTHBSA-N. The full InChI is InChI=1S/C17H19NO3/c19-18-14-7-6-13(11-3-1-2-4-11)17(14)12-5-8-15-16(9-12)21-10-20-15/h5,8-9,11,19H,1-4,6-7,10H2/b18-14+.
What are the key properties of (NE)-N-[2-(1,3-benzodioxol-5-yl)-3-cyclopentylcyclopent-2-en-1-ylidene]hydroxylamine?
(NE)-N-[2-(1,3-benzodioxol-5-yl)-3-cyclopentylcyclopent-2-en-1-ylidene]hydroxylamine has a molecular weight of 285.34 g/mol, XLogP of 3.98, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-[2-(1,3-benzodioxol-5-yl)-3-cyclopentylcyclopent-2-en-1-ylidene]hydroxylamine is sourced from PubChem (CID 11587302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).