About tert-butyl-[[5,5-dimethyl-3-(2-methylprop-2-enyl)oxolan-3-yl]methoxy]-dimethylsilane
tert-butyl-[[5,5-dimethyl-3-(2-methylprop-2-enyl)oxolan-3-yl]methoxy]-dimethylsilane (PubChem CID 11587471) has the molecular formula C17H34O2Si
and a molecular weight of 298.54 g/mol. Its IUPAC name is tert-butyl-[[5,5-dimethyl-3-(2-methylprop-2-enyl)oxolan-3-yl]methoxy]-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[[5,5-dimethyl-3-(2-methylprop-2-enyl)oxolan-3-yl]methoxy]-dimethylsilane |
| PubChem CID | 11587471 |
| Molecular Formula | C17H34O2Si |
| Molecular Weight | 298.54 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | tert-butyl-[[5,5-dimethyl-3-(2-methylprop-2-enyl)oxolan-3-yl]methoxy]-dimethylsilane |
| SMILES | C=C(C)CC1(CO[Si](C)(C)C(C)(C)C)COC(C)(C)C1 |
| InChI | InChI=1S/C17H34O2Si/c1-14(2)10-17(11-16(6,7)18-12-17)13-19-20(8,9)15(3,4)5/h1,10-13H2,2-9H3 |
| InChIKey | YVYQMWXZUNPREB-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.54 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[[5,5-dimethyl-3-(2-methylprop-2-enyl)oxolan-3-yl]methoxy]-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[[5,5-dimethyl-3-(2-methylprop-2-enyl)oxolan-3-yl]methoxy]-dimethylsilane?
The IUPAC name of tert-butyl-[[5,5-dimethyl-3-(2-methylprop-2-enyl)oxolan-3-yl]methoxy]-dimethylsilane (CID 11587471) is tert-butyl-[[5,5-dimethyl-3-(2-methylprop-2-enyl)oxolan-3-yl]methoxy]-dimethylsilane.
What is the SMILES notation for tert-butyl-[[5,5-dimethyl-3-(2-methylprop-2-enyl)oxolan-3-yl]methoxy]-dimethylsilane?
The canonical SMILES for tert-butyl-[[5,5-dimethyl-3-(2-methylprop-2-enyl)oxolan-3-yl]methoxy]-dimethylsilane is C=C(C)CC1(CO[Si](C)(C)C(C)(C)C)COC(C)(C)C1.
What is the InChIKey of tert-butyl-[[5,5-dimethyl-3-(2-methylprop-2-enyl)oxolan-3-yl]methoxy]-dimethylsilane?
The InChIKey is YVYQMWXZUNPREB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34O2Si/c1-14(2)10-17(11-16(6,7)18-12-17)13-19-20(8,9)15(3,4)5/h1,10-13H2,2-9H3.
What are the key properties of tert-butyl-[[5,5-dimethyl-3-(2-methylprop-2-enyl)oxolan-3-yl]methoxy]-dimethylsilane?
tert-butyl-[[5,5-dimethyl-3-(2-methylprop-2-enyl)oxolan-3-yl]methoxy]-dimethylsilane has a molecular weight of 298.54 g/mol, XLogP of 5.16, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[[5,5-dimethyl-3-(2-methylprop-2-enyl)oxolan-3-yl]methoxy]-dimethylsilane is sourced from PubChem (CID 11587471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).