C18H38O3 — CID 11587534
7-(hydroxymethyl)-2,2,12,12-tetramethyltridecane-1,13-diol (PubChem CID 11587534) has the molecular formula C18H38O3 and a molecular weight of 302.50 g/mol. Its IUPAC name is 7-(hydroxymethyl)-2,2,12,12-tetramethyltridecane-1,13-diol.
| Compound Name | 7-(hydroxymethyl)-2,2,12,12-tetramethyltridecane-1,13-diol |
|---|---|
| PubChem CID | 11587534 |
| Molecular Formula | C18H38O3 |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.28 |
| IUPAC Name | 7-(hydroxymethyl)-2,2,12,12-tetramethyltridecane-1,13-diol |
| SMILES | CC(C)(CO)CCCCC(CO)CCCCC(C)(C)CO |
| InChI | InChI=1S/C18H38O3/c1-17(2,14-20)11-7-5-9-16(13-19)10-6-8-12-18(3,4)15-21/h16,19-21H,5-15H2,1-4H3 |
| InChIKey | YCRHVPNLTCVQSW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|