C9H12F3N3S — CID 115875636
N-(1-methylsulfanylpropan-2-yl)-6-(trifluoromethyl)pyridazin-3-amine (PubChem CID 115875636) has the molecular formula C9H12F3N3S and a molecular weight of 251.28 g/mol. Its IUPAC name is N-(1-methylsulfanylpropan-2-yl)-6-(trifluoromethyl)pyridazin-3-amine.
| Compound Name | N-(1-methylsulfanylpropan-2-yl)-6-(trifluoromethyl)pyridazin-3-amine |
|---|---|
| PubChem CID | 115875636 |
| Molecular Formula | C9H12F3N3S |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | N-(1-methylsulfanylpropan-2-yl)-6-(trifluoromethyl)pyridazin-3-amine |
| SMILES | CSCC(C)Nc1ccc(C(F)(F)F)nn1 |
| InChI | InChI=1S/C9H12F3N3S/c1-6(5-16-2)13-8-4-3-7(14-15-8)9(10,11)12/h3-4,6H,5H2,1-2H3,(H,13,15) |
| InChIKey | ZFDSRTNYXWEMNY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |