C19H32O3 — CID 11587615
methyl 2-[(5R)-3,5-diethyl-5-[(E,2R)-2-ethylhex-3-enyl]-2H-furan-2-yl]acetate (PubChem CID 11587615) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is methyl 2-[(5R)-3,5-diethyl-5-[(E,2R)-2-ethylhex-3-enyl]-2H-furan-2-yl]acetate.
| Compound Name | methyl 2-[(5R)-3,5-diethyl-5-[(E,2R)-2-ethylhex-3-enyl]-2H-furan-2-yl]acetate |
|---|---|
| PubChem CID | 11587615 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | methyl 2-[(5R)-3,5-diethyl-5-[(E,2R)-2-ethylhex-3-enyl]-2H-furan-2-yl]acetate |
| SMILES | CC/C=C/[C@H](CC)C[C@]1(CC)C=C(CC)C(CC(=O)OC)O1 |
| InChI | InChI=1S/C19H32O3/c1-6-10-11-15(7-2)13-19(9-4)14-16(8-3)17(22-19)12-18(20)21-5/h10-11,14-15,17H,6-9,12-13H2,1-5H3/b11-10+/t15-,17?,19+/m0/s1 |
| InChIKey | BWYBVMIDXULBBL-UEMZWUDDSA-N |
| XLogP | 4.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|