About (3E)-3-(1,3-benzodioxol-4-ylmethylidene)-6-ethoxy-1H-indol-2-one
(3E)-3-(1,3-benzodioxol-4-ylmethylidene)-6-ethoxy-1H-indol-2-one (PubChem CID 11587619) has the molecular formula C18H15NO4
and a molecular weight of 309.32 g/mol. Its IUPAC name is (3E)-3-(1,3-benzodioxol-4-ylmethylidene)-6-ethoxy-1H-indol-2-one.
Molecular Properties
| Compound Name | (3E)-3-(1,3-benzodioxol-4-ylmethylidene)-6-ethoxy-1H-indol-2-one |
| PubChem CID | 11587619 |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | (3E)-3-(1,3-benzodioxol-4-ylmethylidene)-6-ethoxy-1H-indol-2-one |
| SMILES | CCOc1ccc2c(c1)NC(=O)/C2=C/c1cccc2c1OCO2 |
| InChI | InChI=1S/C18H15NO4/c1-2-21-12-6-7-13-14(18(20)19-15(13)9-12)8-11-4-3-5-16-17(11)23-10-22-16/h3-9H,2,10H2,1H3,(H,19,20)/b14-8+ |
| InChIKey | ZZMSDHVMJGGRRP-RIYZIHGNSA-N |
| XLogP | 3.31 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-(1,3-benzodioxol-4-ylmethylidene)-6-ethoxy-1H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-(1,3-benzodioxol-4-ylmethylidene)-6-ethoxy-1H-indol-2-one?
The IUPAC name of (3E)-3-(1,3-benzodioxol-4-ylmethylidene)-6-ethoxy-1H-indol-2-one (CID 11587619) is (3E)-3-(1,3-benzodioxol-4-ylmethylidene)-6-ethoxy-1H-indol-2-one.
What is the SMILES notation for (3E)-3-(1,3-benzodioxol-4-ylmethylidene)-6-ethoxy-1H-indol-2-one?
The canonical SMILES for (3E)-3-(1,3-benzodioxol-4-ylmethylidene)-6-ethoxy-1H-indol-2-one is CCOc1ccc2c(c1)NC(=O)/C2=C/c1cccc2c1OCO2.
What is the InChIKey of (3E)-3-(1,3-benzodioxol-4-ylmethylidene)-6-ethoxy-1H-indol-2-one?
The InChIKey is ZZMSDHVMJGGRRP-RIYZIHGNSA-N. The full InChI is InChI=1S/C18H15NO4/c1-2-21-12-6-7-13-14(18(20)19-15(13)9-12)8-11-4-3-5-16-17(11)23-10-22-16/h3-9H,2,10H2,1H3,(H,19,20)/b14-8+.
What are the key properties of (3E)-3-(1,3-benzodioxol-4-ylmethylidene)-6-ethoxy-1H-indol-2-one?
(3E)-3-(1,3-benzodioxol-4-ylmethylidene)-6-ethoxy-1H-indol-2-one has a molecular weight of 309.32 g/mol, XLogP of 3.31, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-(1,3-benzodioxol-4-ylmethylidene)-6-ethoxy-1H-indol-2-one is sourced from PubChem (CID 11587619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).