C11H18N2O — CID 115876837
3-methoxy-6-methyl-N-(2-methylpropyl)pyridin-2-amine (PubChem CID 115876837) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 3-methoxy-6-methyl-N-(2-methylpropyl)pyridin-2-amine.
| Compound Name | 3-methoxy-6-methyl-N-(2-methylpropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 115876837 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 3-methoxy-6-methyl-N-(2-methylpropyl)pyridin-2-amine |
| SMILES | COc1ccc(C)nc1NCC(C)C |
| InChI | InChI=1S/C11H18N2O/c1-8(2)7-12-11-10(14-4)6-5-9(3)13-11/h5-6,8H,7H2,1-4H3,(H,12,13) |
| InChIKey | ZXWUJFHBEDOAHF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |