C13H19NO — CID 115876909
N-(2-methylpropyl)-3,4-dihydro-2H-chromen-6-amine (PubChem CID 115876909) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is N-(2-methylpropyl)-3,4-dihydro-2H-chromen-6-amine.
| Compound Name | N-(2-methylpropyl)-3,4-dihydro-2H-chromen-6-amine |
|---|---|
| PubChem CID | 115876909 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | N-(2-methylpropyl)-3,4-dihydro-2H-chromen-6-amine |
| SMILES | CC(C)CNc1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C13H19NO/c1-10(2)9-14-12-5-6-13-11(8-12)4-3-7-15-13/h5-6,8,10,14H,3-4,7,9H2,1-2H3 |
| InChIKey | YFECRGWNIHAIRL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|