C16H29NO5 — CID 11587735
[(1S,6S,7S,8R,8aR)-1,7,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl] octanoate (PubChem CID 11587735) has the molecular formula C16H29NO5 and a molecular weight of 315.41 g/mol. Its IUPAC name is [(1S,6S,7S,8R,8aR)-1,7,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl] octanoate.
| Compound Name | [(1S,6S,7S,8R,8aR)-1,7,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl] octanoate |
|---|---|
| PubChem CID | 11587735 |
| Molecular Formula | C16H29NO5 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | [(1S,6S,7S,8R,8aR)-1,7,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl] octanoate |
| SMILES | CCCCCCCC(=O)OC1CN2CC[C@H](O)[C@@H]2[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H29NO5/c1-2-3-4-5-6-7-13(19)22-12-10-17-9-8-11(18)14(17)16(21)15(12)20/h11-12,14-16,18,20-21H,2-10H2,1H3/t11-,12?,14+,15+,16+/m0/s1 |
| InChIKey | NKURCTMTURLHRY-WZAMJDMESA-N |
| XLogP | 0.43 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|