C19H38O2Si — CID 11587907
(3R,4R,5S,6R)-4-butyl-5-[tert-butyl(dimethyl)silyl]-3-methyl-6-propan-2-yloxan-2-one (PubChem CID 11587907) has the molecular formula C19H38O2Si and a molecular weight of 326.60 g/mol. Its IUPAC name is (3R,4R,5S,6R)-4-butyl-5-[tert-butyl(dimethyl)silyl]-3-methyl-6-propan-2-yloxan-2-one.
| Compound Name | (3R,4R,5S,6R)-4-butyl-5-[tert-butyl(dimethyl)silyl]-3-methyl-6-propan-2-yloxan-2-one |
|---|---|
| PubChem CID | 11587907 |
| Molecular Formula | C19H38O2Si |
| Molecular Weight | 326.60 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | (3R,4R,5S,6R)-4-butyl-5-[tert-butyl(dimethyl)silyl]-3-methyl-6-propan-2-yloxan-2-one |
| SMILES | CCCC[C@H]1[C@H]([Si](C)(C)C(C)(C)C)[C@@H](C(C)C)OC(=O)[C@@H]1C |
| InChI | InChI=1S/C19H38O2Si/c1-10-11-12-15-14(4)18(20)21-16(13(2)3)17(15)22(8,9)19(5,6)7/h13-17H,10-12H2,1-9H3/t14-,15-,16-,17+/m1/s1 |
| InChIKey | BRCYMLJEFJDSBA-VQHPVUNQSA-N |
| XLogP | 5.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.60 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|