C10H13Br2NO — CID 115879563
2-[(3,4-dibromophenyl)methyl-methylamino]ethanol (PubChem CID 115879563) has the molecular formula C10H13Br2NO and a molecular weight of 323.03 g/mol. Its IUPAC name is 2-[(3,4-dibromophenyl)methyl-methylamino]ethanol.
| Compound Name | 2-[(3,4-dibromophenyl)methyl-methylamino]ethanol |
|---|---|
| PubChem CID | 115879563 |
| Molecular Formula | C10H13Br2NO |
| Molecular Weight | 323.03 g/mol |
| Exact Mass | 320.94 |
| IUPAC Name | 2-[(3,4-dibromophenyl)methyl-methylamino]ethanol |
| SMILES | CN(CCO)Cc1ccc(Br)c(Br)c1 |
| InChI | InChI=1S/C10H13Br2NO/c1-13(4-5-14)7-8-2-3-9(11)10(12)6-8/h2-3,6,14H,4-5,7H2,1H3 |
| InChIKey | PURKKLQKJMAAKT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.03 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |