C9H17ClN2O2 — CID 115879856
N-tert-butyl-2-[(2-chloroacetyl)amino]propanamide (PubChem CID 115879856) has the molecular formula C9H17ClN2O2 and a molecular weight of 220.70 g/mol. Its IUPAC name is N-tert-butyl-2-[(2-chloroacetyl)amino]propanamide.
| Compound Name | N-tert-butyl-2-[(2-chloroacetyl)amino]propanamide |
|---|---|
| PubChem CID | 115879856 |
| Molecular Formula | C9H17ClN2O2 |
| Molecular Weight | 220.70 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | N-tert-butyl-2-[(2-chloroacetyl)amino]propanamide |
| SMILES | CC(NC(=O)CCl)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C9H17ClN2O2/c1-6(11-7(13)5-10)8(14)12-9(2,3)4/h6H,5H2,1-4H3,(H,11,13)(H,12,14) |
| InChIKey | RQDGEVHKCXVUJW-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.70 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|