C19H15N3OS — CID 11588022
N-benzyl-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)thiophene-2-carboxamide (PubChem CID 11588022) has the molecular formula C19H15N3OS and a molecular weight of 333.42 g/mol. Its IUPAC name is N-benzyl-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)thiophene-2-carboxamide.
| Compound Name | N-benzyl-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 11588022 |
| Molecular Formula | C19H15N3OS |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | N-benzyl-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)thiophene-2-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1ccc(-c2c[nH]c3ncccc23)s1 |
| InChI | InChI=1S/C19H15N3OS/c23-19(22-11-13-5-2-1-3-6-13)17-9-8-16(24-17)15-12-21-18-14(15)7-4-10-20-18/h1-10,12H,11H2,(H,20,21)(H,22,23) |
| InChIKey | XQJPLSBHRHATHU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |