C11H19N3O2S — CID 115881173
N-(3,3-dimethylcyclopentyl)-1-methylimidazole-4-sulfonamide (PubChem CID 115881173) has the molecular formula C11H19N3O2S and a molecular weight of 257.36 g/mol. Its IUPAC name is N-(3,3-dimethylcyclopentyl)-1-methylimidazole-4-sulfonamide.
| Compound Name | N-(3,3-dimethylcyclopentyl)-1-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 115881173 |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | N-(3,3-dimethylcyclopentyl)-1-methylimidazole-4-sulfonamide |
| SMILES | Cn1cnc(S(=O)(=O)NC2CCC(C)(C)C2)c1 |
| InChI | InChI=1S/C11H19N3O2S/c1-11(2)5-4-9(6-11)13-17(15,16)10-7-14(3)8-12-10/h7-9,13H,4-6H2,1-3H3 |
| InChIKey | TWWLARCQUWRMSS-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |