C15H11F4N3S — CID 11588153
6-(2,4-difluorophenyl)sulfanyl-5,7-difluoro-3-propan-2-yl-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 11588153) has the molecular formula C15H11F4N3S and a molecular weight of 341.33 g/mol. Its IUPAC name is 6-(2,4-difluorophenyl)sulfanyl-5,7-difluoro-3-propan-2-yl-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 6-(2,4-difluorophenyl)sulfanyl-5,7-difluoro-3-propan-2-yl-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 11588153 |
| Molecular Formula | C15H11F4N3S |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 6-(2,4-difluorophenyl)sulfanyl-5,7-difluoro-3-propan-2-yl-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | CC(C)c1nnc2cc(F)c(Sc3ccc(F)cc3F)c(F)n12 |
| InChI | InChI=1S/C15H11F4N3S/c1-7(2)15-21-20-12-6-10(18)13(14(19)22(12)15)23-11-4-3-8(16)5-9(11)17/h3-7H,1-2H3 |
| InChIKey | JAQPSBMNRMXDKB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|