About 3-[6-[2-(3,5-difluorophenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane
3-[6-[2-(3,5-difluorophenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane (PubChem CID 11588154) has the molecular formula C19H17F2N3O
and a molecular weight of 341.36 g/mol. Its IUPAC name is 3-[6-[2-(3,5-difluorophenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane.
Molecular Properties
| Compound Name | 3-[6-[2-(3,5-difluorophenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane |
| PubChem CID | 11588154 |
| Molecular Formula | C19H17F2N3O |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 3-[6-[2-(3,5-difluorophenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane |
| SMILES | Fc1cc(F)cc(C#Cc2ccc(OC3CN4CCC3CC4)nn2)c1 |
| InChI | InChI=1S/C19H17F2N3O/c20-15-9-13(10-16(21)11-15)1-2-17-3-4-19(23-22-17)25-18-12-24-7-5-14(18)6-8-24/h3-4,9-11,14,18H,5-8,12H2 |
| InChIKey | KBZWDHLBZUNDLT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[6-[2-(3,5-difluorophenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-[2-(3,5-difluorophenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane?
The IUPAC name of 3-[6-[2-(3,5-difluorophenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane (CID 11588154) is 3-[6-[2-(3,5-difluorophenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane.
What is the SMILES notation for 3-[6-[2-(3,5-difluorophenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane?
The canonical SMILES for 3-[6-[2-(3,5-difluorophenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane is Fc1cc(F)cc(C#Cc2ccc(OC3CN4CCC3CC4)nn2)c1.
What is the InChIKey of 3-[6-[2-(3,5-difluorophenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane?
The InChIKey is KBZWDHLBZUNDLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17F2N3O/c20-15-9-13(10-16(21)11-15)1-2-17-3-4-19(23-22-17)25-18-12-24-7-5-14(18)6-8-24/h3-4,9-11,14,18H,5-8,12H2.
What are the key properties of 3-[6-[2-(3,5-difluorophenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane?
3-[6-[2-(3,5-difluorophenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane has a molecular weight of 341.36 g/mol, XLogP of 2.63, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-[2-(3,5-difluorophenyl)ethynyl]pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane is sourced from PubChem (CID 11588154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).