About 5-[[2,2-difluoroethyl(methyl)amino]methyl]-1,3-thiazol-2-amine
5-[[2,2-difluoroethyl(methyl)amino]methyl]-1,3-thiazol-2-amine (PubChem CID 115882453) has the molecular formula C7H11F2N3S
and a molecular weight of 207.25 g/mol. Its IUPAC name is 5-[[2,2-difluoroethyl(methyl)amino]methyl]-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-[[2,2-difluoroethyl(methyl)amino]methyl]-1,3-thiazol-2-amine |
| PubChem CID | 115882453 |
| Molecular Formula | C7H11F2N3S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 5-[[2,2-difluoroethyl(methyl)amino]methyl]-1,3-thiazol-2-amine |
| SMILES | CN(Cc1cnc(N)s1)CC(F)F |
| InChI | InChI=1S/C7H11F2N3S/c1-12(4-6(8)9)3-5-2-11-7(10)13-5/h2,6H,3-4H2,1H3,(H2,10,11) |
| InChIKey | YVCOCDQWGJRMQB-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[[2,2-difluoroethyl(methyl)amino]methyl]-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[2,2-difluoroethyl(methyl)amino]methyl]-1,3-thiazol-2-amine?
The IUPAC name of 5-[[2,2-difluoroethyl(methyl)amino]methyl]-1,3-thiazol-2-amine (CID 115882453) is 5-[[2,2-difluoroethyl(methyl)amino]methyl]-1,3-thiazol-2-amine.
What is the SMILES notation for 5-[[2,2-difluoroethyl(methyl)amino]methyl]-1,3-thiazol-2-amine?
The canonical SMILES for 5-[[2,2-difluoroethyl(methyl)amino]methyl]-1,3-thiazol-2-amine is CN(Cc1cnc(N)s1)CC(F)F.
What is the InChIKey of 5-[[2,2-difluoroethyl(methyl)amino]methyl]-1,3-thiazol-2-amine?
The InChIKey is YVCOCDQWGJRMQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F2N3S/c1-12(4-6(8)9)3-5-2-11-7(10)13-5/h2,6H,3-4H2,1H3,(H2,10,11).
What are the key properties of 5-[[2,2-difluoroethyl(methyl)amino]methyl]-1,3-thiazol-2-amine?
5-[[2,2-difluoroethyl(methyl)amino]methyl]-1,3-thiazol-2-amine has a molecular weight of 207.25 g/mol, XLogP of 1.42, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[2,2-difluoroethyl(methyl)amino]methyl]-1,3-thiazol-2-amine is sourced from PubChem (CID 115882453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).