C18H22O4 — CID 11588258
(2E,4E,6E,8E,10E,12E)-2,4,9,13-tetramethyltetradeca-2,4,6,8,10,12-hexaenedioic acid (PubChem CID 11588258) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is (2E,4E,6E,8E,10E,12E)-2,4,9,13-tetramethyltetradeca-2,4,6,8,10,12-hexaenedioic acid.
| Compound Name | (2E,4E,6E,8E,10E,12E)-2,4,9,13-tetramethyltetradeca-2,4,6,8,10,12-hexaenedioic acid |
|---|---|
| PubChem CID | 11588258 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (2E,4E,6E,8E,10E,12E)-2,4,9,13-tetramethyltetradeca-2,4,6,8,10,12-hexaenedioic acid |
| SMILES | CC(/C=C/C=C(\C)C(=O)O)=C\C=C\C=C(C)\C=C(/C)C(=O)O |
| InChI | InChI=1S/C18H22O4/c1-13(10-7-11-15(3)17(19)20)8-5-6-9-14(2)12-16(4)18(21)22/h5-12H,1-4H3,(H,19,20)(H,21,22)/b6-5+,10-7+,13-8+,14-9+,15-11+,16-12+ |
| InChIKey | YXMWTLZMBLQUBZ-QPHQHPALSA-N |
| XLogP | 4.05 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|