C13H21NO2 — CID 115882769
2-[1-[(3-methylfuran-2-yl)methyl]piperidin-3-yl]ethanol (PubChem CID 115882769) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 2-[1-[(3-methylfuran-2-yl)methyl]piperidin-3-yl]ethanol.
| Compound Name | 2-[1-[(3-methylfuran-2-yl)methyl]piperidin-3-yl]ethanol |
|---|---|
| PubChem CID | 115882769 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 2-[1-[(3-methylfuran-2-yl)methyl]piperidin-3-yl]ethanol |
| SMILES | Cc1ccoc1CN1CCCC(CCO)C1 |
| InChI | InChI=1S/C13H21NO2/c1-11-5-8-16-13(11)10-14-6-2-3-12(9-14)4-7-15/h5,8,12,15H,2-4,6-7,9-10H2,1H3 |
| InChIKey | PSXDMERISXSVBR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |