About 2-[[2,2-difluoroethyl(methyl)amino]methyl]-N-ethylpyridin-4-amine
2-[[2,2-difluoroethyl(methyl)amino]methyl]-N-ethylpyridin-4-amine (PubChem CID 115883847) has the molecular formula C11H17F2N3
and a molecular weight of 229.27 g/mol. Its IUPAC name is 2-[[2,2-difluoroethyl(methyl)amino]methyl]-N-ethylpyridin-4-amine.
Molecular Properties
| Compound Name | 2-[[2,2-difluoroethyl(methyl)amino]methyl]-N-ethylpyridin-4-amine |
| PubChem CID | 115883847 |
| Molecular Formula | C11H17F2N3 |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.14 |
| IUPAC Name | 2-[[2,2-difluoroethyl(methyl)amino]methyl]-N-ethylpyridin-4-amine |
| SMILES | CCNc1ccnc(CN(C)CC(F)F)c1 |
| InChI | InChI=1S/C11H17F2N3/c1-3-14-9-4-5-15-10(6-9)7-16(2)8-11(12)13/h4-6,11H,3,7-8H2,1-2H3,(H,14,15) |
| InChIKey | BDZRYQKCVANIKN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[2,2-difluoroethyl(methyl)amino]methyl]-N-ethylpyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2,2-difluoroethyl(methyl)amino]methyl]-N-ethylpyridin-4-amine?
The IUPAC name of 2-[[2,2-difluoroethyl(methyl)amino]methyl]-N-ethylpyridin-4-amine (CID 115883847) is 2-[[2,2-difluoroethyl(methyl)amino]methyl]-N-ethylpyridin-4-amine.
What is the SMILES notation for 2-[[2,2-difluoroethyl(methyl)amino]methyl]-N-ethylpyridin-4-amine?
The canonical SMILES for 2-[[2,2-difluoroethyl(methyl)amino]methyl]-N-ethylpyridin-4-amine is CCNc1ccnc(CN(C)CC(F)F)c1.
What is the InChIKey of 2-[[2,2-difluoroethyl(methyl)amino]methyl]-N-ethylpyridin-4-amine?
The InChIKey is BDZRYQKCVANIKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F2N3/c1-3-14-9-4-5-15-10(6-9)7-16(2)8-11(12)13/h4-6,11H,3,7-8H2,1-2H3,(H,14,15).
What are the key properties of 2-[[2,2-difluoroethyl(methyl)amino]methyl]-N-ethylpyridin-4-amine?
2-[[2,2-difluoroethyl(methyl)amino]methyl]-N-ethylpyridin-4-amine has a molecular weight of 229.27 g/mol, XLogP of 2.21, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2,2-difluoroethyl(methyl)amino]methyl]-N-ethylpyridin-4-amine is sourced from PubChem (CID 115883847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).